C19H17FN2O2S — CID 23770800
2-[4-(4-ethylphenyl)-2-(2-fluoroanilino)-1,3-thiazol-5-yl]acetic acid (PubChem CID 23770800) has the molecular formula C19H17FN2O2S and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[4-(4-ethylphenyl)-2-(2-fluoroanilino)-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[4-(4-ethylphenyl)-2-(2-fluoroanilino)-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 23770800 |
| Molecular Formula | C19H17FN2O2S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[4-(4-ethylphenyl)-2-(2-fluoroanilino)-1,3-thiazol-5-yl]acetic acid |
| SMILES | CCc1ccc(-c2nc(Nc3ccccc3F)sc2CC(=O)O)cc1 |
| InChI | InChI=1S/C19H17FN2O2S/c1-2-12-7-9-13(10-8-12)18-16(11-17(23)24)25-19(22-18)21-15-6-4-3-5-14(15)20/h3-10H,2,11H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | QVCNCVLPEDOFCG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |