C14H15F3N2OS — CID 58496121
[4-propyl-2-[3-(trifluoromethyl)anilino]-1,3-thiazol-5-yl]methanol (PubChem CID 58496121) has the molecular formula C14H15F3N2OS and a molecular weight of 316.35 g/mol. Its IUPAC name is [4-propyl-2-[3-(trifluoromethyl)anilino]-1,3-thiazol-5-yl]methanol.
| Compound Name | [4-propyl-2-[3-(trifluoromethyl)anilino]-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 58496121 |
| Molecular Formula | C14H15F3N2OS |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [4-propyl-2-[3-(trifluoromethyl)anilino]-1,3-thiazol-5-yl]methanol |
| SMILES | CCCc1nc(Nc2cccc(C(F)(F)F)c2)sc1CO |
| InChI | InChI=1S/C14H15F3N2OS/c1-2-4-11-12(8-20)21-13(19-11)18-10-6-3-5-9(7-10)14(15,16)17/h3,5-7,20H,2,4,8H2,1H3,(H,18,19) |
| InChIKey | AUYURQGYWKKRBE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |