C26H27N3 — CID 7728865
2-(4-tert-butylphenyl)-N-(2,4-dimethylphenyl)quinazolin-4-amine (PubChem CID 7728865) has the molecular formula C26H27N3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-(2,4-dimethylphenyl)quinazolin-4-amine.
| Compound Name | 2-(4-tert-butylphenyl)-N-(2,4-dimethylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 7728865 |
| Molecular Formula | C26H27N3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-(2,4-dimethylphenyl)quinazolin-4-amine |
| SMILES | Cc1ccc(Nc2nc(-c3ccc(C(C)(C)C)cc3)nc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C26H27N3/c1-17-10-15-22(18(2)16-17)27-25-21-8-6-7-9-23(21)28-24(29-25)19-11-13-20(14-12-19)26(3,4)5/h6-16H,1-5H3,(H,27,28,29) |
| InChIKey | LUUBZQWZPFGZGA-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |