C23H26N3O2- — CID 7728907
(2R)-2-[[2-(4-tert-butylphenyl)quinazolin-4-yl]amino]-3-methylbutanoate (PubChem CID 7728907) has the molecular formula C23H26N3O2- and a molecular weight of 376.48 g/mol. Its IUPAC name is (2R)-2-[[2-(4-tert-butylphenyl)quinazolin-4-yl]amino]-3-methylbutanoate.
| Compound Name | (2R)-2-[[2-(4-tert-butylphenyl)quinazolin-4-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7728907 |
| Molecular Formula | C23H26N3O2- |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (2R)-2-[[2-(4-tert-butylphenyl)quinazolin-4-yl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](Nc1nc(-c2ccc(C(C)(C)C)cc2)nc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C23H27N3O2/c1-14(2)19(22(27)28)25-21-17-8-6-7-9-18(17)24-20(26-21)15-10-12-16(13-11-15)23(3,4)5/h6-14,19H,1-5H3,(H,27,28)(H,24,25,26)/p-1/t19-/m1/s1 |
| InChIKey | XSKWSUUPPSDJFU-LJQANCHMSA-M |
| XLogP | 3.78 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |