C17H14N3O3- — CID 6926985
(2S)-3-hydroxy-2-[(2-phenylquinazolin-4-yl)amino]propanoate (PubChem CID 6926985) has the molecular formula C17H14N3O3- and a molecular weight of 308.32 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(2-phenylquinazolin-4-yl)amino]propanoate.
| Compound Name | (2S)-3-hydroxy-2-[(2-phenylquinazolin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 6926985 |
| Molecular Formula | C17H14N3O3- |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2S)-3-hydroxy-2-[(2-phenylquinazolin-4-yl)amino]propanoate |
| SMILES | O=C([O-])[C@H](CO)Nc1nc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C17H15N3O3/c21-10-14(17(22)23)19-16-12-8-4-5-9-13(12)18-15(20-16)11-6-2-1-3-7-11/h1-9,14,21H,10H2,(H,22,23)(H,18,19,20)/p-1/t14-/m0/s1 |
| InChIKey | TUTDJJOPMGCNMC-AWEZNQCLSA-M |
| XLogP | 0.82 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |