C17H14N3O2- — CID 3679551
3-phenyl-2-(quinazolin-4-ylamino)propanoate (PubChem CID 3679551) has the molecular formula C17H14N3O2- and a molecular weight of 292.32 g/mol. Its IUPAC name is 3-phenyl-2-(quinazolin-4-ylamino)propanoate.
| Compound Name | 3-phenyl-2-(quinazolin-4-ylamino)propanoate |
|---|---|
| PubChem CID | 3679551 |
| Molecular Formula | C17H14N3O2- |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-phenyl-2-(quinazolin-4-ylamino)propanoate |
| SMILES | O=C([O-])C(Cc1ccccc1)Nc1ncnc2ccccc12 |
| InChI | InChI=1S/C17H15N3O2/c21-17(22)15(10-12-6-2-1-3-7-12)20-16-13-8-4-5-9-14(13)18-11-19-16/h1-9,11,15H,10H2,(H,21,22)(H,18,19,20)/p-1 |
| InChIKey | LTKPIKDYYKMLDA-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |