C14H16N3O2- — CID 6922206
(2R)-4-methyl-2-(quinazolin-4-ylamino)pentanoate (PubChem CID 6922206) has the molecular formula C14H16N3O2- and a molecular weight of 258.30 g/mol. Its IUPAC name is (2R)-4-methyl-2-(quinazolin-4-ylamino)pentanoate.
| Compound Name | (2R)-4-methyl-2-(quinazolin-4-ylamino)pentanoate |
|---|---|
| PubChem CID | 6922206 |
| Molecular Formula | C14H16N3O2- |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2R)-4-methyl-2-(quinazolin-4-ylamino)pentanoate |
| SMILES | CC(C)C[C@@H](Nc1ncnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C14H17N3O2/c1-9(2)7-12(14(18)19)17-13-10-5-3-4-6-11(10)15-8-16-13/h3-6,8-9,12H,7H2,1-2H3,(H,18,19)(H,15,16,17)/p-1/t12-/m1/s1 |
| InChIKey | ZXCCLHAPTDCVKL-GFCCVEGCSA-M |
| XLogP | 1.21 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |