C13H14N3O2- — CID 6927209
(2R)-2-[(6-methylquinazolin-4-yl)amino]butanoate (PubChem CID 6927209) has the molecular formula C13H14N3O2- and a molecular weight of 244.27 g/mol. Its IUPAC name is (2R)-2-[(6-methylquinazolin-4-yl)amino]butanoate.
| Compound Name | (2R)-2-[(6-methylquinazolin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 6927209 |
| Molecular Formula | C13H14N3O2- |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2R)-2-[(6-methylquinazolin-4-yl)amino]butanoate |
| SMILES | CC[C@@H](Nc1ncnc2ccc(C)cc12)C(=O)[O-] |
| InChI | InChI=1S/C13H15N3O2/c1-3-10(13(17)18)16-12-9-6-8(2)4-5-11(9)14-7-15-12/h4-7,10H,3H2,1-2H3,(H,17,18)(H,14,15,16)/p-1/t10-/m1/s1 |
| InChIKey | PFDYUSVIMPBSPD-SNVBAGLBSA-M |
| XLogP | 0.88 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |