C17H22BrN5O — CID 163215892
(2S)-2-[(6-bromoquinazolin-4-yl)amino]-1-(4-methylpiperazin-1-yl)butan-1-one (PubChem CID 163215892) has the molecular formula C17H22BrN5O and a molecular weight of 392.30 g/mol. Its IUPAC name is (2S)-2-[(6-bromoquinazolin-4-yl)amino]-1-(4-methylpiperazin-1-yl)butan-1-one.
| Compound Name | (2S)-2-[(6-bromoquinazolin-4-yl)amino]-1-(4-methylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 163215892 |
| Molecular Formula | C17H22BrN5O |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | (2S)-2-[(6-bromoquinazolin-4-yl)amino]-1-(4-methylpiperazin-1-yl)butan-1-one |
| SMILES | CC[C@H](Nc1ncnc2ccc(Br)cc12)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H22BrN5O/c1-3-14(17(24)23-8-6-22(2)7-9-23)21-16-13-10-12(18)4-5-15(13)19-11-20-16/h4-5,10-11,14H,3,6-9H2,1-2H3,(H,19,20,21)/t14-/m0/s1 |
| InChIKey | UKZJSOYIBJVMRX-AWEZNQCLSA-N |
| XLogP | 2.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |