C21H24N4O — CID 158822658
2-amino-1-phenyl-7-(quinazolin-4-ylamino)heptan-4-one (PubChem CID 158822658) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-amino-1-phenyl-7-(quinazolin-4-ylamino)heptan-4-one.
| Compound Name | 2-amino-1-phenyl-7-(quinazolin-4-ylamino)heptan-4-one |
|---|---|
| PubChem CID | 158822658 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-amino-1-phenyl-7-(quinazolin-4-ylamino)heptan-4-one |
| SMILES | NC(CC(=O)CCCNc1ncnc2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C21H24N4O/c22-17(13-16-7-2-1-3-8-16)14-18(26)9-6-12-23-21-19-10-4-5-11-20(19)24-15-25-21/h1-5,7-8,10-11,15,17H,6,9,12-14,22H2,(H,23,24,25) |
| InChIKey | IWBJBAQNDAEYMF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|