C18H19N5O — CID 110436147
N-(pyridin-2-ylmethyl)-4-(quinazolin-4-ylamino)butanamide (PubChem CID 110436147) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-4-(quinazolin-4-ylamino)butanamide.
| Compound Name | N-(pyridin-2-ylmethyl)-4-(quinazolin-4-ylamino)butanamide |
|---|---|
| PubChem CID | 110436147 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-4-(quinazolin-4-ylamino)butanamide |
| SMILES | O=C(CCCNc1ncnc2ccccc12)NCc1ccccn1 |
| InChI | InChI=1S/C18H19N5O/c24-17(21-12-14-6-3-4-10-19-14)9-5-11-20-18-15-7-1-2-8-16(15)22-13-23-18/h1-4,6-8,10,13H,5,9,11-12H2,(H,21,24)(H,20,22,23) |
| InChIKey | NRGWWOVQIRJZSU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|