C14H15N7O — CID 42537147
3-(7H-purin-6-ylamino)-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 42537147) has the molecular formula C14H15N7O and a molecular weight of 297.32 g/mol. Its IUPAC name is 3-(7H-purin-6-ylamino)-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | 3-(7H-purin-6-ylamino)-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 42537147 |
| Molecular Formula | C14H15N7O |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3-(7H-purin-6-ylamino)-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | O=C(CCNc1ncnc2nc[nH]c12)NCc1ccccn1 |
| InChI | InChI=1S/C14H15N7O/c22-11(17-7-10-3-1-2-5-15-10)4-6-16-13-12-14(19-8-18-12)21-9-20-13/h1-3,5,8-9H,4,6-7H2,(H,17,22)(H2,16,18,19,20,21) |
| InChIKey | RCDTWMGNOBTFMM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |