C11H16N6O — CID 47299148
N-propyl-3-(7H-purin-6-ylamino)propanamide (PubChem CID 47299148) has the molecular formula C11H16N6O and a molecular weight of 248.29 g/mol. Its IUPAC name is N-propyl-3-(7H-purin-6-ylamino)propanamide.
| Compound Name | N-propyl-3-(7H-purin-6-ylamino)propanamide |
|---|---|
| PubChem CID | 47299148 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | N-propyl-3-(7H-purin-6-ylamino)propanamide |
| SMILES | CCCNC(=O)CCNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H16N6O/c1-2-4-12-8(18)3-5-13-10-9-11(15-6-14-9)17-7-16-10/h6-7H,2-5H2,1H3,(H,12,18)(H2,13,14,15,16,17) |
| InChIKey | RZEKLEZWYLYYFX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |