C10H13N5O2 — CID 65226734
2-[(7H-purin-6-ylamino)methyl]butanoic acid (PubChem CID 65226734) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-[(7H-purin-6-ylamino)methyl]butanoic acid.
| Compound Name | 2-[(7H-purin-6-ylamino)methyl]butanoic acid |
|---|---|
| PubChem CID | 65226734 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-[(7H-purin-6-ylamino)methyl]butanoic acid |
| SMILES | CCC(CNc1ncnc2nc[nH]c12)C(=O)O |
| InChI | InChI=1S/C10H13N5O2/c1-2-6(10(16)17)3-11-8-7-9(13-4-12-7)15-5-14-8/h4-6H,2-3H2,1H3,(H,16,17)(H2,11,12,13,14,15) |
| InChIKey | RXZDCLKDJHWZJU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |