C11H16ClN5O2 — CID 167991552
(2S)-2-(7H-purin-6-ylamino)hexanoic acid;hydrochloride (PubChem CID 167991552) has the molecular formula C11H16ClN5O2 and a molecular weight of 285.74 g/mol. Its IUPAC name is (2S)-2-(7H-purin-6-ylamino)hexanoic acid;hydrochloride.
| Compound Name | (2S)-2-(7H-purin-6-ylamino)hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 167991552 |
| Molecular Formula | C11H16ClN5O2 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (2S)-2-(7H-purin-6-ylamino)hexanoic acid;hydrochloride |
| SMILES | CCCC[C@H](Nc1ncnc2nc[nH]c12)C(=O)O.Cl |
| InChI | InChI=1S/C11H15N5O2.ClH/c1-2-3-4-7(11(17)18)16-10-8-9(13-5-12-8)14-6-15-10;/h5-7H,2-4H2,1H3,(H,17,18)(H2,12,13,14,15,16);1H/t7-;/m0./s1 |
| InChIKey | GXPQQVCPHMLFPS-FJXQXJEOSA-N |
| XLogP | 1.83 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |