C11H19N5 — CID 154667457
N-butyl-7H-purin-6-amine;ethane (PubChem CID 154667457) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is N-butyl-7H-purin-6-amine;ethane.
| Compound Name | N-butyl-7H-purin-6-amine;ethane |
|---|---|
| PubChem CID | 154667457 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-butyl-7H-purin-6-amine;ethane |
| SMILES | CC.CCCCNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C9H13N5.C2H6/c1-2-3-4-10-8-7-9(12-5-11-7)14-6-13-8;1-2/h5-6H,2-4H2,1H3,(H2,10,11,12,13,14);1-2H3 |
| InChIKey | CHDLYBVKPDLSGP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|