C10H12N8 — CID 113412966
N-[3-(triazol-1-yl)propyl]-7H-purin-6-amine (PubChem CID 113412966) has the molecular formula C10H12N8 and a molecular weight of 244.26 g/mol. Its IUPAC name is N-[3-(triazol-1-yl)propyl]-7H-purin-6-amine.
| Compound Name | N-[3-(triazol-1-yl)propyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 113412966 |
| Molecular Formula | C10H12N8 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-[3-(triazol-1-yl)propyl]-7H-purin-6-amine |
| SMILES | c1cn(CCCNc2ncnc3nc[nH]c23)nn1 |
| InChI | InChI=1S/C10H12N8/c1(4-18-5-3-16-17-18)2-11-9-8-10(13-6-12-8)15-7-14-9/h3,5-7H,1-2,4H2,(H2,11,12,13,14,15) |
| InChIKey | WZDKJAPYQBYCRA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|