C11H13N7S — CID 39826375
N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-7H-purin-6-amine (PubChem CID 39826375) has the molecular formula C11H13N7S and a molecular weight of 275.34 g/mol. Its IUPAC name is N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-7H-purin-6-amine.
| Compound Name | N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 39826375 |
| Molecular Formula | C11H13N7S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-7H-purin-6-amine |
| SMILES | Cn1ccnc1SCCNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H13N7S/c1-18-4-2-13-11(18)19-5-3-12-9-8-10(15-6-14-8)17-7-16-9/h2,4,6-7H,3,5H2,1H3,(H2,12,14,15,16,17) |
| InChIKey | JZQROHPJXUQWAV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|