C11H15N5O2 — CID 114285512
2,2-dimethyl-4-(7H-purin-6-ylamino)butanoic acid (PubChem CID 114285512) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2,2-dimethyl-4-(7H-purin-6-ylamino)butanoic acid.
| Compound Name | 2,2-dimethyl-4-(7H-purin-6-ylamino)butanoic acid |
|---|---|
| PubChem CID | 114285512 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2,2-dimethyl-4-(7H-purin-6-ylamino)butanoic acid |
| SMILES | CC(C)(CCNc1ncnc2nc[nH]c12)C(=O)O |
| InChI | InChI=1S/C11H15N5O2/c1-11(2,10(17)18)3-4-12-8-7-9(14-5-13-7)16-6-15-8/h5-6H,3-4H2,1-2H3,(H,17,18)(H2,12,13,14,15,16) |
| InChIKey | RBKLSCQOLZWETP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |