C15H18N6 — CID 756726
N'-benzyl-N'-methyl-N-(7H-purin-6-yl)ethane-1,2-diamine (PubChem CID 756726) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is N'-benzyl-N'-methyl-N-(7H-purin-6-yl)ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-methyl-N-(7H-purin-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 756726 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N'-benzyl-N'-methyl-N-(7H-purin-6-yl)ethane-1,2-diamine |
| SMILES | CN(CCNc1ncnc2nc[nH]c12)Cc1ccccc1 |
| InChI | InChI=1S/C15H18N6/c1-21(9-12-5-3-2-4-6-12)8-7-16-14-13-15(18-10-17-13)20-11-19-14/h2-6,10-11H,7-9H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | MPRFAIWXWQJZEY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |