C15H19IN4O — CID 136973680
4-[3-[benzyl(methyl)amino]propylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136973680) has the molecular formula C15H19IN4O and a molecular weight of 398.25 g/mol. Its IUPAC name is 4-[3-[benzyl(methyl)amino]propylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[3-[benzyl(methyl)amino]propylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136973680 |
| Molecular Formula | C15H19IN4O |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 4-[3-[benzyl(methyl)amino]propylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CN(CCCNc1nc[nH]c(=O)c1I)Cc1ccccc1 |
| InChI | InChI=1S/C15H19IN4O/c1-20(10-12-6-3-2-4-7-12)9-5-8-17-14-13(16)15(21)19-11-18-14/h2-4,6-7,11H,5,8-10H2,1H3,(H2,17,18,19,21) |
| InChIKey | NJISNMBJWTXGOS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|