C12H10F2IN3O — CID 136956551
4-[2-(3,5-difluorophenyl)ethylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136956551) has the molecular formula C12H10F2IN3O and a molecular weight of 377.13 g/mol. Its IUPAC name is 4-[2-(3,5-difluorophenyl)ethylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(3,5-difluorophenyl)ethylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956551 |
| Molecular Formula | C12H10F2IN3O |
| Molecular Weight | 377.13 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 4-[2-(3,5-difluorophenyl)ethylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCc2cc(F)cc(F)c2)c1I |
| InChI | InChI=1S/C12H10F2IN3O/c13-8-3-7(4-9(14)5-8)1-2-16-11-10(15)12(19)18-6-17-11/h3-6H,1-2H2,(H2,16,17,18,19) |
| InChIKey | RICUQHFQUFJHOT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|