C9H11IN6O — CID 136956954
5-iodo-4-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]-1H-pyrimidin-6-one (PubChem CID 136956954) has the molecular formula C9H11IN6O and a molecular weight of 346.13 g/mol. Its IUPAC name is 5-iodo-4-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956954 |
| Molecular Formula | C9H11IN6O |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 5-iodo-4-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]-1H-pyrimidin-6-one |
| SMILES | Cn1cnc(CCNc2nc[nH]c(=O)c2I)n1 |
| InChI | InChI=1S/C9H11IN6O/c1-16-5-14-6(15-16)2-3-11-8-7(10)9(17)13-4-12-8/h4-5H,2-3H2,1H3,(H2,11,12,13,17) |
| InChIKey | WZQRRXRCBZBMBH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|