C12H13IN4O2 — CID 136977960
4-[2-(4-aminophenoxy)ethylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136977960) has the molecular formula C12H13IN4O2 and a molecular weight of 372.17 g/mol. Its IUPAC name is 4-[2-(4-aminophenoxy)ethylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(4-aminophenoxy)ethylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136977960 |
| Molecular Formula | C12H13IN4O2 |
| Molecular Weight | 372.17 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 4-[2-(4-aminophenoxy)ethylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | Nc1ccc(OCCNc2nc[nH]c(=O)c2I)cc1 |
| InChI | InChI=1S/C12H13IN4O2/c13-10-11(16-7-17-12(10)18)15-5-6-19-9-3-1-8(14)2-4-9/h1-4,7H,5-6,14H2,(H2,15,16,17,18) |
| InChIKey | WDYYAFXJDJVRGO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|