C15H18Cl2N4 — CID 79639329
N'-benzyl-N-(2,5-dichloropyrimidin-4-yl)-N'-methylpropane-1,3-diamine (PubChem CID 79639329) has the molecular formula C15H18Cl2N4 and a molecular weight of 325.24 g/mol. Its IUPAC name is N'-benzyl-N-(2,5-dichloropyrimidin-4-yl)-N'-methylpropane-1,3-diamine.
| Compound Name | N'-benzyl-N-(2,5-dichloropyrimidin-4-yl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79639329 |
| Molecular Formula | C15H18Cl2N4 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N'-benzyl-N-(2,5-dichloropyrimidin-4-yl)-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNc1nc(Cl)ncc1Cl)Cc1ccccc1 |
| InChI | InChI=1S/C15H18Cl2N4/c1-21(11-12-6-3-2-4-7-12)9-5-8-18-14-13(16)10-19-15(17)20-14/h2-4,6-7,10H,5,8-9,11H2,1H3,(H,18,19,20) |
| InChIKey | PCPBGCQIFDIJTQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|