C15H20ClN3S — CID 104878492
N'-benzyl-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-N'-methylpropane-1,3-diamine (PubChem CID 104878492) has the molecular formula C15H20ClN3S and a molecular weight of 309.87 g/mol. Its IUPAC name is N'-benzyl-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-benzyl-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 104878492 |
| Molecular Formula | C15H20ClN3S |
| Molecular Weight | 309.87 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N'-benzyl-N-[(5-chloro-1,3-thiazol-2-yl)methyl]-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNCc1ncc(Cl)s1)Cc1ccccc1 |
| InChI | InChI=1S/C15H20ClN3S/c1-19(12-13-6-3-2-4-7-13)9-5-8-17-11-15-18-10-14(16)20-15/h2-4,6-7,10,17H,5,8-9,11-12H2,1H3 |
| InChIKey | SEWXWDYJGWMFOT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|