C14H15ClN4S — CID 104878480
3-(benzimidazol-1-yl)-N-[(5-chloro-1,3-thiazol-2-yl)methyl]propan-1-amine (PubChem CID 104878480) has the molecular formula C14H15ClN4S and a molecular weight of 306.82 g/mol. Its IUPAC name is 3-(benzimidazol-1-yl)-N-[(5-chloro-1,3-thiazol-2-yl)methyl]propan-1-amine.
| Compound Name | 3-(benzimidazol-1-yl)-N-[(5-chloro-1,3-thiazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 104878480 |
| Molecular Formula | C14H15ClN4S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-(benzimidazol-1-yl)-N-[(5-chloro-1,3-thiazol-2-yl)methyl]propan-1-amine |
| SMILES | Clc1cnc(CNCCCn2cnc3ccccc32)s1 |
| InChI | InChI=1S/C14H15ClN4S/c15-13-8-17-14(20-13)9-16-6-3-7-19-10-18-11-4-1-2-5-12(11)19/h1-2,4-5,8,10,16H,3,6-7,9H2 |
| InChIKey | AVPNATOPNNBWDX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|