C14H16N4S — CID 55109662
3-(benzimidazol-1-yl)-N-(1,3-thiazol-5-ylmethyl)propan-1-amine (PubChem CID 55109662) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 3-(benzimidazol-1-yl)-N-(1,3-thiazol-5-ylmethyl)propan-1-amine.
| Compound Name | 3-(benzimidazol-1-yl)-N-(1,3-thiazol-5-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 55109662 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-(benzimidazol-1-yl)-N-(1,3-thiazol-5-ylmethyl)propan-1-amine |
| SMILES | c1ccc2c(c1)ncn2CCCNCc1cncs1 |
| InChI | InChI=1S/C14H16N4S/c1-2-5-14-13(4-1)17-10-18(14)7-3-6-15-8-12-9-16-11-19-12/h1-2,4-5,9-11,15H,3,6-8H2 |
| InChIKey | GAFMUPMIIIIGCV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|