C18H21N3O3 — CID 110176675
4-[2-[3-(benzimidazol-1-yl)propylamino]-1-hydroxyethyl]benzene-1,2-diol (PubChem CID 110176675) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[2-[3-(benzimidazol-1-yl)propylamino]-1-hydroxyethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[3-(benzimidazol-1-yl)propylamino]-1-hydroxyethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 110176675 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-[2-[3-(benzimidazol-1-yl)propylamino]-1-hydroxyethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(C(O)CNCCCn2cnc3ccccc32)cc1O |
| InChI | InChI=1S/C18H21N3O3/c22-16-7-6-13(10-17(16)23)18(24)11-19-8-3-9-21-12-20-14-4-1-2-5-15(14)21/h1-2,4-7,10,12,18-19,22-24H,3,8-9,11H2 |
| InChIKey | WYDZGYUKKMYJCO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|