C17H15F2N3O — CID 86912487
N-[3-(benzimidazol-1-yl)propyl]-2,6-difluorobenzamide (PubChem CID 86912487) has the molecular formula C17H15F2N3O and a molecular weight of 315.32 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-2,6-difluorobenzamide.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 86912487 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-2,6-difluorobenzamide |
| SMILES | O=C(NCCCn1cnc2ccccc21)c1c(F)cccc1F |
| InChI | InChI=1S/C17H15F2N3O/c18-12-5-3-6-13(19)16(12)17(23)20-9-4-10-22-11-21-14-7-1-2-8-15(14)22/h1-3,5-8,11H,4,9-10H2,(H,20,23) |
| InChIKey | CBMVHIQEUYOBCT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|