C15H15BrN4O — CID 51256035
N-[3-(benzimidazol-1-yl)propyl]-4-bromo-1H-pyrrole-2-carboxamide (PubChem CID 51256035) has the molecular formula C15H15BrN4O and a molecular weight of 347.22 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-4-bromo-1H-pyrrole-2-carboxamide.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-4-bromo-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 51256035 |
| Molecular Formula | C15H15BrN4O |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-4-bromo-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCCn1cnc2ccccc21)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C15H15BrN4O/c16-11-8-13(18-9-11)15(21)17-6-3-7-20-10-19-12-4-1-2-5-14(12)20/h1-2,4-5,8-10,18H,3,6-7H2,(H,17,21) |
| InChIKey | BJWJDAABLKXNGJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|