C20H16F2N4O2 — CID 91949588
N-[3-(benzimidazol-1-yl)propyl]-5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 91949588) has the molecular formula C20H16F2N4O2 and a molecular weight of 382.37 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 91949588 |
| Molecular Formula | C20H16F2N4O2 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-5-(3,4-difluorophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCn1cnc2ccccc21)c1cc(-c2ccc(F)c(F)c2)on1 |
| InChI | InChI=1S/C20H16F2N4O2/c21-14-7-6-13(10-15(14)22)19-11-17(25-28-19)20(27)23-8-3-9-26-12-24-16-4-1-2-5-18(16)26/h1-2,4-7,10-12H,3,8-9H2,(H,23,27) |
| InChIKey | CLMUWTNLOZQZKM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|