C14H13N3OS — CID 51091236
N-[2-(benzimidazol-1-yl)ethyl]thiophene-2-carboxamide (PubChem CID 51091236) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is N-[2-(benzimidazol-1-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(benzimidazol-1-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 51091236 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[2-(benzimidazol-1-yl)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCn1cnc2ccccc21)c1cccs1 |
| InChI | InChI=1S/C14H13N3OS/c18-14(13-6-3-9-19-13)15-7-8-17-10-16-11-4-1-2-5-12(11)17/h1-6,9-10H,7-8H2,(H,15,18) |
| InChIKey | HPDHSHOFSWCLIC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |