C14H18N2O7 — CID 19069897
4-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]butanenitrile;oxalic acid (PubChem CID 19069897) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is 4-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]butanenitrile;oxalic acid.
| Compound Name | 4-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]butanenitrile;oxalic acid |
|---|---|
| PubChem CID | 19069897 |
| Molecular Formula | C14H18N2O7 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]butanenitrile;oxalic acid |
| SMILES | N#CCCCNCC(O)c1ccc(O)c(O)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H16N2O3.C2H2O4/c13-5-1-2-6-14-8-12(17)9-3-4-10(15)11(16)7-9;3-1(4)2(5)6/h3-4,7,12,14-17H,1-2,6,8H2;(H,3,4)(H,5,6) |
| InChIKey | DNZXIGWGFQDZNT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 171.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|