C24H36Cl2N4O6 — CID 21438047
N-[5-[2-[6-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide;dihydrochloride (PubChem CID 21438047) has the molecular formula C24H36Cl2N4O6 and a molecular weight of 547.48 g/mol. Its IUPAC name is N-[5-[2-[6-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide;dihydrochloride.
| Compound Name | N-[5-[2-[6-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide;dihydrochloride |
|---|---|
| PubChem CID | 21438047 |
| Molecular Formula | C24H36Cl2N4O6 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | N-[5-[2-[6-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide;dihydrochloride |
| SMILES | Cl.Cl.O=CNc1cc(C(O)CNCCCCCCNCC(O)c2ccc(O)c(NC=O)c2)ccc1O |
| InChI | InChI=1S/C24H34N4O6.2ClH/c29-15-27-19-11-17(5-7-21(19)31)23(33)13-25-9-3-1-2-4-10-26-14-24(34)18-6-8-22(32)20(12-18)28-16-30;;/h5-8,11-12,15-16,23-26,31-34H,1-4,9-10,13-14H2,(H,27,29)(H,28,30);2*1H |
| InChIKey | NGAIYQCCNOOOTC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 163.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|