C24H34N4O6 — CID 21435549
N-[5-[2-[6-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide (PubChem CID 21435549) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-[5-[2-[6-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[2-[6-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 21435549 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-[5-[2-[6-[[2-(3-formamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
| SMILES | O=CNc1cc(C(O)CNCCCCCCNCC(O)c2ccc(O)c(NC=O)c2)ccc1O |
| InChI | InChI=1S/C24H34N4O6/c29-15-27-19-11-17(5-7-21(19)31)23(33)13-25-9-3-1-2-4-10-26-14-24(34)18-6-8-22(32)20(12-18)28-16-30/h5-8,11-12,15-16,23-26,31-34H,1-4,9-10,13-14H2,(H,27,29)(H,28,30) |
| InChIKey | SRDQAMBJVWWHBE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 163.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|