C25H30N4O3 — CID 11178908
N-[5-[(1R)-2-[2-[4-[[(2R)-2-amino-2-phenylethyl]amino]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide (PubChem CID 11178908) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[5-[(1R)-2-[2-[4-[[(2R)-2-amino-2-phenylethyl]amino]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[(1R)-2-[2-[4-[[(2R)-2-amino-2-phenylethyl]amino]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 11178908 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[5-[(1R)-2-[2-[4-[[(2R)-2-amino-2-phenylethyl]amino]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
| SMILES | N[C@@H](CNc1ccc(CCNC[C@H](O)c2ccc(O)c(NC=O)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H30N4O3/c26-22(19-4-2-1-3-5-19)15-28-21-9-6-18(7-10-21)12-13-27-16-25(32)20-8-11-24(31)23(14-20)29-17-30/h1-11,14,17,22,25,27-28,31-32H,12-13,15-16,26H2,(H,29,30)/t22-,25-/m0/s1 |
| InChIKey | LTXGWWXFKJELNM-DHLKQENFSA-N |
| XLogP | 2.94 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|