C25H30N2O4 — CID 69230233
4-[1-hydroxy-2-[2-[4-[(2-hydroxy-2-phenylethyl)amino]phenyl]ethylamino]ethyl]-3-methylbenzene-1,2-diol (PubChem CID 69230233) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-[1-hydroxy-2-[2-[4-[(2-hydroxy-2-phenylethyl)amino]phenyl]ethylamino]ethyl]-3-methylbenzene-1,2-diol.
| Compound Name | 4-[1-hydroxy-2-[2-[4-[(2-hydroxy-2-phenylethyl)amino]phenyl]ethylamino]ethyl]-3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 69230233 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-[1-hydroxy-2-[2-[4-[(2-hydroxy-2-phenylethyl)amino]phenyl]ethylamino]ethyl]-3-methylbenzene-1,2-diol |
| SMILES | Cc1c(C(O)CNCCc2ccc(NCC(O)c3ccccc3)cc2)ccc(O)c1O |
| InChI | InChI=1S/C25H30N2O4/c1-17-21(11-12-22(28)25(17)31)24(30)15-26-14-13-18-7-9-20(10-8-18)27-16-23(29)19-5-3-2-4-6-19/h2-12,23-24,26-31H,13-16H2,1H3 |
| InChIKey | OFIQIKUPBAAJFC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|