C25H30N4O4 — CID 71158727
[2-hydroxy-5-[1-hydroxy-2-[2-[4-[(2-hydroxy-2-phenylethyl)amino]phenyl]ethylamino]ethyl]phenyl]urea (PubChem CID 71158727) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is [2-hydroxy-5-[1-hydroxy-2-[2-[4-[(2-hydroxy-2-phenylethyl)amino]phenyl]ethylamino]ethyl]phenyl]urea.
| Compound Name | [2-hydroxy-5-[1-hydroxy-2-[2-[4-[(2-hydroxy-2-phenylethyl)amino]phenyl]ethylamino]ethyl]phenyl]urea |
|---|---|
| PubChem CID | 71158727 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [2-hydroxy-5-[1-hydroxy-2-[2-[4-[(2-hydroxy-2-phenylethyl)amino]phenyl]ethylamino]ethyl]phenyl]urea |
| SMILES | NC(=O)Nc1cc(C(O)CNCCc2ccc(NCC(O)c3ccccc3)cc2)ccc1O |
| InChI | InChI=1S/C25H30N4O4/c26-25(33)29-21-14-19(8-11-22(21)30)23(31)15-27-13-12-17-6-9-20(10-7-17)28-16-24(32)18-4-2-1-3-5-18/h1-11,14,23-24,27-28,30-32H,12-13,15-16H2,(H3,26,29,33) |
| InChIKey | LXLKNYJKYWYUMD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|