C25H28N4O4 — CID 46193587
N-[4-[2-[[2-(3-acetamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide (PubChem CID 46193587) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[4-[2-[[2-(3-acetamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[4-[2-[[2-(3-acetamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 46193587 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[4-[2-[[2-(3-acetamido-4-hydroxyphenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide |
| SMILES | CC(=O)Nc1cc(C(O)CNCCc2ccc(NC(=O)Cc3ccccn3)cc2)ccc1O |
| InChI | InChI=1S/C25H28N4O4/c1-17(30)28-22-14-19(7-10-23(22)31)24(32)16-26-13-11-18-5-8-20(9-6-18)29-25(33)15-21-4-2-3-12-27-21/h2-10,12,14,24,26,31-32H,11,13,15-16H2,1H3,(H,28,30)(H,29,33) |
| InChIKey | LCPGUNXODIOKTJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|