C23H25Cl2N3O2 — CID 46193817
N-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide;hydrochloride (PubChem CID 46193817) has the molecular formula C23H25Cl2N3O2 and a molecular weight of 446.38 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide;hydrochloride.
| Compound Name | N-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 46193817 |
| Molecular Formula | C23H25Cl2N3O2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-pyridin-2-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(Cc1ccccn1)Nc1ccc(CCNC[C@H](O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H24ClN3O2.ClH/c24-19-5-3-4-18(14-19)22(28)16-25-13-11-17-7-9-20(10-8-17)27-23(29)15-21-6-1-2-12-26-21;/h1-10,12,14,22,25,28H,11,13,15-16H2,(H,27,29);1H/t22-;/m0./s1 |
| InChIKey | NPCQZCZVGUNYRM-FTBISJDPSA-N |
| XLogP | 4.20 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|