C23H28Cl2N4O2 — CID 18319828
2-(6-amino-2-pyridinyl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide;dihydrochloride (PubChem CID 18319828) has the molecular formula C23H28Cl2N4O2 and a molecular weight of 463.41 g/mol. Its IUPAC name is 2-(6-amino-2-pyridinyl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide;dihydrochloride.
| Compound Name | 2-(6-amino-2-pyridinyl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 18319828 |
| Molecular Formula | C23H28Cl2N4O2 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-(6-amino-2-pyridinyl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(CC(=O)Nc2ccc(CCNCC(O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C23H26N4O2.2ClH/c24-22-8-4-7-20(26-22)15-23(29)27-19-11-9-17(10-12-19)13-14-25-16-21(28)18-5-2-1-3-6-18;;/h1-12,21,25,28H,13-16H2,(H2,24,26)(H,27,29);2*1H |
| InChIKey | OWUDLWXKYLWQSD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|