C20H23ClN4O2S — CID 18319720
2-amino-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 18319720) has the molecular formula C20H23ClN4O2S and a molecular weight of 418.95 g/mol. Its IUPAC name is 2-amino-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | 2-amino-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18319720 |
| Molecular Formula | C20H23ClN4O2S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-amino-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | Cl.Nc1nc(C(=O)Nc2ccc(CCNCC(O)c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C20H22N4O2S.ClH/c21-20-24-17(13-27-20)19(26)23-16-8-6-14(7-9-16)10-11-22-12-18(25)15-4-2-1-3-5-15;/h1-9,13,18,22,25H,10-12H2,(H2,21,24)(H,23,26);1H |
| InChIKey | HZVNTAYVFIFJHV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|