C12H11N3O3S — CID 62786875
2-[4-[(2-amino-1,3-thiazole-4-carbonyl)amino]phenyl]acetic acid (PubChem CID 62786875) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[4-[(2-amino-1,3-thiazole-4-carbonyl)amino]phenyl]acetic acid.
| Compound Name | 2-[4-[(2-amino-1,3-thiazole-4-carbonyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 62786875 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[4-[(2-amino-1,3-thiazole-4-carbonyl)amino]phenyl]acetic acid |
| SMILES | Nc1nc(C(=O)Nc2ccc(CC(=O)O)cc2)cs1 |
| InChI | InChI=1S/C12H11N3O3S/c13-12-15-9(6-19-12)11(18)14-8-3-1-7(2-4-8)5-10(16)17/h1-4,6H,5H2,(H2,13,15)(H,14,18)(H,16,17) |
| InChIKey | QIXXWCRUUSQTOL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |