C13H14N4O2S — CID 62798897
2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]acetamide (PubChem CID 62798897) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]acetamide.
| Compound Name | 2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 62798897 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]acetamide |
| SMILES | NC(=O)Cc1ccc(NC(=O)Cc2csc(N)n2)cc1 |
| InChI | InChI=1S/C13H14N4O2S/c14-11(18)5-8-1-3-9(4-2-8)16-12(19)6-10-7-20-13(15)17-10/h1-4,7H,5-6H2,(H2,14,18)(H2,15,17)(H,16,19) |
| InChIKey | FYEYJSYFQDKJRL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |