C9H9N3OS2 — CID 66351961
2-(2-amino-1,3-thiazol-4-yl)-N-thiophen-3-ylacetamide (PubChem CID 66351961) has the molecular formula C9H9N3OS2 and a molecular weight of 239.33 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-thiophen-3-ylacetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 66351961 |
| Molecular Formula | C9H9N3OS2 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-thiophen-3-ylacetamide |
| SMILES | Nc1nc(CC(=O)Nc2ccsc2)cs1 |
| InChI | InChI=1S/C9H9N3OS2/c10-9-12-7(5-15-9)3-8(13)11-6-1-2-14-4-6/h1-2,4-5H,3H2,(H2,10,12)(H,11,13) |
| InChIKey | XSZDCIXTRQENQP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |