C13H11N3OS2 — CID 62798357
2-(2-amino-1,3-thiazol-4-yl)-N-(1-benzothiophen-5-yl)acetamide (PubChem CID 62798357) has the molecular formula C13H11N3OS2 and a molecular weight of 289.39 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-(1-benzothiophen-5-yl)acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(1-benzothiophen-5-yl)acetamide |
|---|---|
| PubChem CID | 62798357 |
| Molecular Formula | C13H11N3OS2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(1-benzothiophen-5-yl)acetamide |
| SMILES | Nc1nc(CC(=O)Nc2ccc3sccc3c2)cs1 |
| InChI | InChI=1S/C13H11N3OS2/c14-13-16-10(7-19-13)6-12(17)15-9-1-2-11-8(5-9)3-4-18-11/h1-5,7H,6H2,(H2,14,16)(H,15,17) |
| InChIKey | DMHMYYADPCZUIM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |