C11H8Cl2FN3OS — CID 107574425
2-(2-amino-1,3-thiazol-4-yl)-N-(3,5-dichloro-4-fluorophenyl)acetamide (PubChem CID 107574425) has the molecular formula C11H8Cl2FN3OS and a molecular weight of 320.18 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-(3,5-dichloro-4-fluorophenyl)acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(3,5-dichloro-4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 107574425 |
| Molecular Formula | C11H8Cl2FN3OS |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(3,5-dichloro-4-fluorophenyl)acetamide |
| SMILES | Nc1nc(CC(=O)Nc2cc(Cl)c(F)c(Cl)c2)cs1 |
| InChI | InChI=1S/C11H8Cl2FN3OS/c12-7-1-5(2-8(13)10(7)14)16-9(18)3-6-4-19-11(15)17-6/h1-2,4H,3H2,(H2,15,17)(H,16,18) |
| InChIKey | UGZIAQPDRDNVSP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|