C12H10ClN3O3S — CID 62800000
4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-chlorobenzoic acid (PubChem CID 62800000) has the molecular formula C12H10ClN3O3S and a molecular weight of 311.75 g/mol. Its IUPAC name is 4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-chlorobenzoic acid.
| Compound Name | 4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 62800000 |
| Molecular Formula | C12H10ClN3O3S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-2-chlorobenzoic acid |
| SMILES | Nc1nc(CC(=O)Nc2ccc(C(=O)O)c(Cl)c2)cs1 |
| InChI | InChI=1S/C12H10ClN3O3S/c13-9-3-6(1-2-8(9)11(18)19)15-10(17)4-7-5-20-12(14)16-7/h1-3,5H,4H2,(H2,14,16)(H,15,17)(H,18,19) |
| InChIKey | RXQNEZODMDVIHL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |