C14H13ClN2O3S — CID 71916844
2-chloro-4-[[2-(2-ethyl-1,3-thiazol-4-yl)acetyl]amino]benzoic acid (PubChem CID 71916844) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is 2-chloro-4-[[2-(2-ethyl-1,3-thiazol-4-yl)acetyl]amino]benzoic acid.
| Compound Name | 2-chloro-4-[[2-(2-ethyl-1,3-thiazol-4-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 71916844 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-chloro-4-[[2-(2-ethyl-1,3-thiazol-4-yl)acetyl]amino]benzoic acid |
| SMILES | CCc1nc(CC(=O)Nc2ccc(C(=O)O)c(Cl)c2)cs1 |
| InChI | InChI=1S/C14H13ClN2O3S/c1-2-13-17-9(7-21-13)6-12(18)16-8-3-4-10(14(19)20)11(15)5-8/h3-5,7H,2,6H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | FEPAKFXNUSXRHK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |